25117-74-2 4-Ethoxybenzonitrile
상품명칭 |
4-Ethoxybenzonitrile |
영문 이름 |
4-Ethoxybenzonitrile; 4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
분자식 |
C9H9NO |
분자량 |
147.1739 |
InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
cas번호 |
25117-74-2 |
분자 구조 |
|
밀도 |
1.05g/cm3 |
비등점 |
258°C at 760 mmHg |
굴절 지수 |
1.52 |
인화점 |
110.9°C |
증기압 |
0.0141mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|