ChemNet > CAS > 25173-72-2 3-(3,4,5-Trimethoxyphenyl)propionic acid
25173-72-2 3-(3,4,5-Trimethoxyphenyl)propionic acid
| 상품명칭 |
3-(3,4,5-Trimethoxyphenyl)propionic acid |
| 영문 이름 |
3-(3,4,5-Trimethoxyphenyl)propionic acid; 3,4,5-Trimethoxyhydrocinnamic acid; 3-(3,4,5-trimethoxyphenyl)propanoic acid; 3-(3,4,5-trimethoxyphenyl)propanoate |
| 분자식 |
C12H15O5 |
| 분자량 |
239.245 |
| InChI |
InChI=1/C12H16O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h6-7H,4-5H2,1-3H3,(H,13,14)/p-1 |
| cas번호 |
25173-72-2 |
| EC번호 |
246-706-4 |
| 분자 구조 |
|
| 녹는 점 |
100-105℃ |
| 비등점 |
373.3°C at 760 mmHg |
| 인화점 |
139.9°C |
| 증기압 |
3.1E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
