ChemNet > CAS > 2527-99-3 Methyl 5-bromo-2-furoate
2527-99-3 Methyl 5-bromo-2-furoate
| 상품명칭 |
Methyl 5-bromo-2-furoate |
| 영문 이름 |
Methyl 5-bromo-2-furoate; methyl 5-bromofuran-2-carboxylate |
| 분자식 |
C6H5BrO3 |
| 분자량 |
205.0061 |
| InChI |
InChI=1/C6H5BrO3/c1-9-6(8)4-2-3-5(7)10-4/h2-3H,1H3 |
| cas번호 |
2527-99-3 |
| 분자 구조 |
|
| 밀도 |
1.623g/cm3 |
| 녹는 점 |
62-65℃ |
| 비등점 |
226.3°C at 760 mmHg |
| 굴절 지수 |
1.513 |
| 인화점 |
90.7°C |
| 증기압 |
0.0824mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
