25309-64-2 4-Ethyliodobenzene
상품명칭 |
4-Ethyliodobenzene |
영문 이름 |
4-Ethyliodobenzene; 1-Ethyl-4-iodobenzene; 2-chlorocyclohexyl oxo(phenyl)acetate |
분자식 |
C8H9I |
분자량 |
232.0615 |
InChI |
InChI=1/C8H9I/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
cas번호 |
25309-64-2 |
분자 구조 |
|
밀도 |
1.607g/cm3 |
비등점 |
209.6°C at 760 mmHg |
굴절 지수 |
1.59 |
인화점 |
88.6°C |
증기압 |
0.291mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|