ChemNet > CAS > 25369-78-2 5-Chloro-2-mercaptobenzimidazole
25369-78-2 5-Chloro-2-mercaptobenzimidazole
| 상품명칭 |
5-Chloro-2-mercaptobenzimidazole |
| 영문 이름 |
5-Chloro-2-mercaptobenzimidazole; 5-Chlorobenzimidazole-2-thiol; 6-chloro-1H-benzimidazole-2-thiol |
| 분자식 |
C7H5ClN2S |
| 분자량 |
184.646 |
| InChI |
InChI=1/C7H5ClN2S/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,(H2,9,10,11) |
| cas번호 |
25369-78-2 |
| EC번호 |
246-903-5 |
| 분자 구조 |
|
| 밀도 |
1.54g/cm3 |
| 녹는 점 |
290-292℃ |
| 비등점 |
300.7°C at 760 mmHg |
| 굴절 지수 |
1.75 |
| 인화점 |
135.6°C |
| 증기압 |
0.0011mmHg at 25°C |
| 위험성 표시 |
 T:Toxic;
|
| 리스크 규칙 |
R25:Toxic if swallowed.;
|
| 보안 규칙 |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
