ChemNet > CAS > 25570-02-9 3,3',5,5'-Tetramethylbiphenyl
25570-02-9 3,3',5,5'-Tetramethylbiphenyl
상품명칭 |
3,3',5,5'-Tetramethylbiphenyl |
영문 이름 |
3,3',5,5'-Tetramethylbiphenyl; |
분자식 |
C16H18 |
분자량 |
210.3141 |
InChI |
InChI=1/C16H18/c1-11-5-12(2)8-15(7-11)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
cas번호 |
25570-02-9 |
분자 구조 |
|
밀도 |
0.956g/cm3 |
비등점 |
300.9°C at 760 mmHg |
굴절 지수 |
1.551 |
인화점 |
138.7°C |
증기압 |
0.00195mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|