ChemNet > CAS > 25781-92-4 5-Chloro-2-nitrodiphenylamine
25781-92-4 5-Chloro-2-nitrodiphenylamine
| 상품명칭 |
5-Chloro-2-nitrodiphenylamine |
| 영문 이름 |
5-Chloro-2-nitrodiphenylamine; 2-nitro-5-chlorodiphenyl amine; 5-chloro-2-nitro-N-phenylaniline |
| 분자식 |
C12H9ClN2O2 |
| 분자량 |
248.6651 |
| InChI |
InChI=1/C12H9ClN2O2/c13-9-6-7-12(15(16)17)11(8-9)14-10-4-2-1-3-5-10/h1-8,14H |
| cas번호 |
25781-92-4 |
| EC번호 |
247-261-9 |
| 분자 구조 |
|
| 밀도 |
1.387g/cm3 |
| 녹는 점 |
110-114℃ |
| 비등점 |
370.4°C at 760 mmHg |
| 굴절 지수 |
1.671 |
| 인화점 |
177.8°C |
| 증기압 |
1.11E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
