ChemNet > CAS > 2586-62-1 1-Bromo-2-methylnaphthalene
2586-62-1 1-Bromo-2-methylnaphthalene
상품명칭 |
1-Bromo-2-methylnaphthalene |
영문 이름 |
1-Bromo-2-methylnaphthalene; 1-Bromo-2-methylnaphtalene |
분자식 |
C11H9Br |
분자량 |
221.0932 |
InChI |
InChI=1/C11H9Br/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-7H,1H3 |
cas번호 |
2586-62-1 |
EC번호 |
219-966-1 |
분자 구조 |
|
밀도 |
1.417g/cm3 |
비등점 |
300.9°C at 760 mmHg |
굴절 지수 |
1.645 |
인화점 |
137.4°C |
증기압 |
0.00195mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|