25870-62-6 1-Phenyl-2-hexanone
상품명칭 |
1-Phenyl-2-hexanone |
영문 이름 |
1-Phenyl-2-hexanone; Benzyl n-butyl ketone; 1-phenylhexan-2-one |
분자식 |
C12H16O |
분자량 |
176.2548 |
InChI |
InChI=1/C12H16O/c1-2-3-9-12(13)10-11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3 |
cas번호 |
25870-62-6 |
EC번호 |
247-306-2 |
분자 구조 |
|
밀도 |
0.95g/cm3 |
비등점 |
258°C at 760 mmHg |
굴절 지수 |
1.498 |
인화점 |
104.2°C |
증기압 |
0.0141mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|