ChemNet > CAS > 261762-35-0 5-Bromo-2,3-difluoroanisole
261762-35-0 5-Bromo-2,3-difluoroanisole
상품명칭 |
5-Bromo-2,3-difluoroanisole |
영문 이름 |
5-Bromo-2,3-difluoroanisole; 2.3-Difluoro-5-Bromoanisole; 5-bromo-1,2-difluoro-3-methoxybenzene |
분자식 |
C7H5BrF2O |
분자량 |
223.0148 |
InChI |
InChI=1/C7H5BrF2O/c1-11-6-3-4(8)2-5(9)7(6)10/h2-3H,1H3 |
cas번호 |
261762-35-0 |
분자 구조 |
|
밀도 |
1.615g/cm3 |
비등점 |
193.7°C at 760 mmHg |
굴절 지수 |
1.5 |
인화점 |
84.6°C |
증기압 |
0.639mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|