ChemNet > CAS > 261762-43-0 3-Chloro-2,6-difluorobenzoyl chloride
261762-43-0 3-Chloro-2,6-difluorobenzoyl chloride
| 상품명칭 |
3-Chloro-2,6-difluorobenzoyl chloride |
| 영문 이름 |
3-Chloro-2,6-difluorobenzoyl chloride; |
| 분자식 |
C7H2Cl2F2O |
| 분자량 |
210.993 |
| InChI |
InChI=1/C7H2Cl2F2O/c8-3-1-2-4(10)5(6(3)11)7(9)12/h1-2H |
| cas번호 |
261762-43-0 |
| 분자 구조 |
|
| 밀도 |
1.548g/cm3 |
| 비등점 |
203.9°C at 760 mmHg |
| 굴절 지수 |
1.519 |
| 인화점 |
77.1°C |
| 증기압 |
0.271mmHg at 25°C |
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|