ChemNet > CAS > 261762-45-2 2-Chloro-3,6-difluorobenzylamine
261762-45-2 2-Chloro-3,6-difluorobenzylamine
상품명칭 |
2-Chloro-3,6-difluorobenzylamine |
영문 이름 |
2-Chloro-3,6-difluorobenzylamine;1-(2-chloro-3,6-difluorophenyl)methanamine |
분자식 |
C7H6ClF2N |
분자량 |
177.579 |
InChI |
InChI=1/C7H6ClF2N/c8-7-4(3-11)5(9)1-2-6(7)10/h1-2H,3,11H2 |
cas번호 |
261762-45-2 |
분자 구조 |
|
밀도 |
1.368g/cm3 |
비등점 |
210.3°C at 760 mmHg |
굴절 지수 |
1.522 |
인화점 |
81°C |
증기압 |
0.194mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|