2628-17-3 4-Vinylphenol
상품명칭 |
4-Vinylphenol |
영문 이름 |
4-Vinylphenol; 4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
분자식 |
C8H8O |
분자량 |
120.15 |
InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
cas번호 |
2628-17-3 |
EC번호 |
220-103-6 |
분자 구조 |
|
녹는 점 |
73℃ |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|