2642-98-0 6-Aminochrysene
상품명칭 |
6-Aminochrysene |
영문 이름 |
6-Aminochrysene; 6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
분자식 |
C18H13N |
분자량 |
243.3025 |
InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
cas번호 |
2642-98-0 |
EC번호 |
220-149-7 |
분자 구조 |
|
밀도 |
1.253g/cm3 |
녹는 점 |
206-211℃ |
비등점 |
501.2°C at 760 mmHg |
굴절 지수 |
1.813 |
인화점 |
286.9°C |
증기압 |
3.56E-10mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|