ChemNet > CAS > 266312-58-7 5-(2,4-디클로로페닐)-4-(2-푸릴메틸)-4H-1,2,4-트리아졸-3-티올
266312-58-7 5-(2,4-디클로로페닐)-4-(2-푸릴메틸)-4H-1,2,4-트리아졸-3-티올
| 상품명칭 |
5-(2,4-디클로로페닐)-4-(2-푸릴메틸)-4H-1,2,4-트리아졸-3-티올 |
| 별명 |
5-(2,4-디클로로페닐)-4-(푸란-2-일메틸)-2,4-디하이드로-3H-1,2,4-트리아졸-3-티온 |
| 영문 이름 |
5-(2,4-dichlorophenyl)-4-(2-furylmethyl)-4H-1,2,4-triazole-3-thiol;5-(2,4-dichlorophenyl)-4-(furan-2-ylmethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione |
| 분자식 |
C13H9Cl2N3OS |
| 분자량 |
326.2011 |
| InChI |
InChI=1/C13H9Cl2N3OS/c14-8-3-4-10(11(15)6-8)12-16-17-13(20)18(12)7-9-2-1-5-19-9/h1-6H,7H2,(H,17,20) |
| cas번호 |
266312-58-7 |
| 분자 구조 |
|
| 밀도 |
1.55g/cm3 |
| 녹는 점 |
158℃ |
| 비등점 |
426.3°C at 760 mmHg |
| 굴절 지수 |
1.716 |
| 인화점 |
211.6°C |
| 증기압 |
1.79E-07mmHg at 25°C |
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|