ChemNet > CAS > 26685-82-5 (1S,2R)-(+)-cis-2-Benzamidocyclohexanecarboxylic acid
26685-82-5 (1S,2R)-(+)-cis-2-Benzamidocyclohexanecarboxylic acid
상품명칭 |
(1S,2R)-(+)-cis-2-Benzamidocyclohexanecarboxylic acid |
영문 이름 |
(1S,2R)-(+)-cis-2-Benzamidocyclohexanecarboxylic acid; cis-(1S,2R)-(+)-2-Benzamidocyclohexanecarboxylic acid; (+)-cis-2-Benzamidocyclohexanecarboxylic acid; 2-(benzoylamino)cyclohexanecarboxylic acid; (1S,2R)-2-(benzoylamino)cyclohexanecarboxylic acid; (1S,2R)-2-[(phenylcarbonyl)amino]cyclohexanecarboxylate |
분자식 |
C14H16NO3 |
분자량 |
246.2823 |
InChI |
InChI=1/C14H17NO3/c16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18/h1-3,6-7,11-12H,4-5,8-9H2,(H,15,16)(H,17,18)/p-1/t11-,12+/m0/s1 |
cas번호 |
26685-82-5 |
분자 구조 |
|
녹는 점 |
204℃ |
비등점 |
506.1°C at 760 mmHg |
인화점 |
259.9°C |
증기압 |
4.59E-11mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|