ChemNet > CAS > 2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
| 상품명칭 |
Trimethyl 1,3,5-benzenetricarboxylate |
| 영문 이름 |
Trimethyl 1,3,5-benzenetricarboxylate; Trimethyl benzene-1,3,5-tricarboxylate; Trimethyl Trimesate; 1,3,5-Benzenetricarboxylic acid trimethyl ester; benzene-1,3,5-triyl triacetate; trimethyl cyclohexane-1,3,5-tricarboxylate |
| 분자식 |
C12H18O6 |
| 분자량 |
258.2677 |
| InChI |
InChI=1/C12H18O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h7-9H,4-6H2,1-3H3 |
| cas번호 |
2672-58-4 |
| EC번호 |
220-215-5 |
| 분자 구조 |
|
| 밀도 |
1.177g/cm3 |
| 녹는 점 |
144-147℃ |
| 비등점 |
332.8°C at 760 mmHg |
| 굴절 지수 |
1.464 |
| 인화점 |
144.1°C |
| 증기압 |
0.000142mmHg at 25°C |
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|