ChemNet > CAS > 2694-54-4 Triallyl Trimellitate
2694-54-4 Triallyl Trimellitate
| 상품명칭 |
Triallyl Trimellitate |
| 영문 이름 |
Triallyl Trimellitate; 1,2,4-Benzenetricarboxylic acid triallyl ester; Trimellitic acid triallyl ester; triprop-2-en-1-yl benzene-1,2,4-tricarboxylate |
| 분자식 |
C18H18O6 |
| 분자량 |
330.3319 |
| InChI |
InChI=1/C18H18O6/c1-4-9-22-16(19)13-7-8-14(17(20)23-10-5-2)15(12-13)18(21)24-11-6-3/h4-8,12H,1-3,9-11H2 |
| cas번호 |
2694-54-4 |
| EC번호 |
220-264-2 |
| 분자 구조 |
|
| 밀도 |
1.149g/cm3 |
| 비등점 |
438.1°C at 760 mmHg |
| 굴절 지수 |
1.528 |
| 인화점 |
191.3°C |
| 증기압 |
7.07E-08mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
