ChemNet > CAS > 2719-08-6 Methyl 2-acetamidobenzoate
2719-08-6 Methyl 2-acetamidobenzoate
상품명칭 |
Methyl 2-acetamidobenzoate |
영문 이름 |
Methyl 2-acetamidobenzoate; methyl 2-(acetylamino)benzoate; Methyl N-acetylanthranilate; ACETYL-N-METHYL-ANTHRANILATE |
분자식 |
C10H11NO3 |
분자량 |
193.1992 |
InChI |
InChI=1/C10H11NO3/c1-7(12)11-9-6-4-3-5-8(9)10(13)14-2/h3-6H,1-2H3,(H,11,12) |
cas번호 |
2719-08-6 |
EC번호 |
220-318-5 |
분자 구조 |
|
밀도 |
1.204g/cm3 |
녹는 점 |
97-101℃ |
비등점 |
376.3°C at 760 mmHg |
굴절 지수 |
1.565 |
인화점 |
181.4°C |
증기압 |
7.3E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|