275-51-4 Azulene
상품명칭 |
Azulene |
영문 이름 |
Azulene; Bicyclo[5.3.0]decapentaene; Azunamic; Cyclopentacycloheptene; Bicyclo(5.3.0)-deca-2,4,6,8,10-pentaene; Bicyclo(5.3.0)-1,3,5,7,9-decapentaene; EINECS |
분자식 |
C10H8 |
분자량 |
128.1705 |
InChI |
InChI=1/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
cas번호 |
275-51-4 |
EC번호 |
205-993-6 |
분자 구조 |
|
밀도 |
1.037g/cm3 |
녹는 점 |
99-101℃ |
비등점 |
220.7°C at 760 mmHg |
굴절 지수 |
1.632 |
인화점 |
76.7°C |
증기압 |
0.165mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|