27554-26-3 diisooctyl phthalate
상품명칭 |
diisooctyl phthalate |
영문 이름 |
diisooctyl phthalate; diisooctyl phthalate, mixed isomers; diiso-octyl phthalate; diiso-octyl orthophthalate; 1,2-Benzenedicarboxylic Acid Diisoctyl Ester; Di-iso-octyl phthalate; bis(6-methylheptyl) benzene-1,2-dicarboxylate; Phthalate Dioctyl |
분자식 |
C24H38O4 |
분자량 |
390.5561 |
InChI |
InChI=1/C24H38O4/c1-19(2)13-7-5-11-17-27-23(25)21-15-9-10-16-22(21)24(26)28-18-12-6-8-14-20(3)4/h9-10,15-16,19-20H,5-8,11-14,17-18H2,1-4H3 |
cas번호 |
27554-26-3 |
EC번호 |
248-523-5 |
분자 구조 |
|
밀도 |
0.983g/cm3 |
비등점 |
384.9°C at 760 mmHg |
굴절 지수 |
1.488 |
인화점 |
204.5°C |
증기압 |
3.95E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R2:Risk of explosion by shock, friction, fire or other sources of ignition.;
R24/25:Toxic in contact with skin and if swallowed.;
|
보안 규칙 |
S2:;
S24/25:;
|
|