ChemNet > CAS > 2757-23-5 chlorocarbonylsulfenyl chloride
2757-23-5 chlorocarbonylsulfenyl chloride
상품명칭 |
chlorocarbonylsulfenyl chloride |
영문 이름 |
chlorocarbonylsulfenyl chloride; Chloro(chlorosulfanyl)oxomethane; Methane, chloro(chlorothio)oxo- |
분자식 |
CCl2OS |
분자량 |
130.9811 |
InChI |
InChI=1/CCl2OS/c2-1(4)5-3 |
cas번호 |
2757-23-5 |
EC번호 |
220-415-2 |
분자 구조 |
|
밀도 |
1.66g/cm3 |
비등점 |
98°C at 760 mmHg |
굴절 지수 |
1.53 |
인화점 |
53.7°C |
증기압 |
40.7mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|