27638-00-2 딜라우린 (C12:0)
| 상품명칭 |
딜라우린 (C12:0) |
| 별명 |
딜라우린; 도데칸산, 1,2,3-프로판트리올을 함유한 디에스테르; 글리세릴 디라우레이트; 라우르산, 글리세롤이 함유된 디에스터; 3-하이드록시프로판-1,2-디일 디도데카노에이트 |
| 영문 이름 |
dilaurin (C12:0);Dilaurin; Dodecanoic acid, diester with 1,2,3-propanetriol; Glyceryl dilaurate; Lauric acid, diester with glycerol; 3-hydroxypropane-1,2-diyl didodecanoate |
| 분자식 |
C27H52O5 |
| 분자량 |
456.6988 |
| InChI |
InChI=1/C27H52O5/c1-3-5-7-9-11-13-15-17-19-21-26(29)31-24-25(23-28)32-27(30)22-20-18-16-14-12-10-8-6-4-2/h25,28H,3-24H2,1-2H3 |
| cas번호 |
27638-00-2 |
| EC번호 |
248-586-9 |
| 분자 구조 |
|
| 밀도 |
0.953g/cm3 |
| 비등점 |
531°C at 760 mmHg |
| 굴절 지수 |
1.463 |
| 인화점 |
158°C |
| 증기압 |
1.71E-13mmHg at 25°C |
|