ChemNet > CAS > 2768-56-1 N-Carbobenzyloxy-DL-serine
2768-56-1 N-Carbobenzyloxy-DL-serine
상품명칭 |
N-Carbobenzyloxy-DL-serine |
영문 이름 |
N-Carbobenzyloxy-DL-serine; N-cbz-dl-serine crystalline; carbobenzyloxy-dl-serine; Z-dl-serine; N-benzyloxycarbonyl-DL-serine; Z-DL-Ser-OH; N-((benzyloxy)carbonyl)serine; N-CBZ-DL-Serine N-Carbobenzyloxy-DL-serine; Carbobenzoxyserine; N-CBZ-DL-Serine; N-Carbobenzoxy-DL-serine; (2S)-2-{[(benzyloxy)carbonyl]amino}-3-hydroxypropanoate; (2R)-2-{[(benzyloxy)carbonyl]amino}-3-hydroxypropanoate; Cbz-DL-serine |
분자식 |
C11H12NO5 |
분자량 |
238.2172 |
InChI |
InChI=1/C11H13NO5/c13-6-9(10(14)15)12-11(16)17-7-8-4-2-1-3-5-8/h1-5,9,13H,6-7H2,(H,12,16)(H,14,15)/p-1/t9-/m1/s1 |
cas번호 |
2768-56-1 |
EC번호 |
220-455-0 |
분자 구조 |
|
녹는 점 |
122-126℃ |
비등점 |
487.5°C at 760 mmHg |
인화점 |
248.6°C |
증기압 |
2.56E-10mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|