ChemNet > CAS > 27775-00-4 isononylamine, mixture of isomeric nonylamines
27775-00-4 isononylamine, mixture of isomeric nonylamines
상품명칭 |
isononylamine, mixture of isomeric nonylamines |
영문 이름 |
isononylamine, mixture of isomeric nonylamines; Isononylamine; 7-methyloctan-1-amine |
분자식 |
C9H21N |
분자량 |
143.2697 |
InChI |
InChI=1/C9H21N/c1-9(2)7-5-3-4-6-8-10/h9H,3-8,10H2,1-2H3 |
cas번호 |
27775-00-4 |
EC번호 |
248-653-2 |
분자 구조 |
|
밀도 |
0.79g/cm3 |
비등점 |
191°C at 760 mmHg |
굴절 지수 |
1.434 |
인화점 |
69.8°C |
증기압 |
0.526mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|