2778-96-3 stearyl stearate
상품명칭 |
stearyl stearate |
영문 이름 |
stearyl stearate; stearic acid stearyl ester; octadecyl octadecanoate |
분자식 |
C36H72O2 |
분자량 |
536.9557 |
InChI |
InChI=1/C36H72O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-36(37)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-35H2,1-2H3 |
cas번호 |
2778-96-3 |
EC번호 |
220-476-5 |
분자 구조 |
|
밀도 |
0.857g/cm3 |
비등점 |
549.1°C at 760 mmHg |
굴절 지수 |
1.457 |
인화점 |
297°C |
증기압 |
4.14E-12mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|