ChemNet > CAS > 27829-72-7 ethyl trans-2-hexenoate
27829-72-7 ethyl trans-2-hexenoate
상품명칭 |
ethyl trans-2-hexenoate |
영문 이름 |
ethyl trans-2-hexenoate; trans-2-Hexenoic acid ethyl ester; ethyl (2E)-hex-2-enoate; Ethyl (E)-Hex-2-Enoate |
분자식 |
C8H14O2 |
분자량 |
142.1956 |
InChI |
InChI=1/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h6-7H,3-5H2,1-2H3/b7-6+ |
cas번호 |
27829-72-7 |
EC번호 |
248-681-5 |
분자 구조 |
|
밀도 |
0.901g/cm3 |
비등점 |
172.6°C at 760 mmHg |
굴절 지수 |
1.432 |
인화점 |
62.3°C |
증기압 |
1.32mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|