2783-17-7 1,12-diaminododecane
상품명칭 |
1,12-diaminododecane |
영문 이름 |
1,12-diaminododecane; Diaminododecane; dodecamethylenediamine; 1,12-Dodecanediamine; 1,12-Dodecyl diamine; dodecane-1,12-diamine; dodecane-1,12-diaminium dichloride; dodecane-1,1-diamine |
분자식 |
C12H28N2 |
분자량 |
200.3641 |
InChI |
InChI=1/C12H28N2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h12H,2-11,13-14H2,1H3 |
cas번호 |
2783-17-7 |
EC번호 |
220-489-6 |
분자 구조 |
|
밀도 |
0.855g/cm3 |
녹는 점 |
69-71℃ |
비등점 |
283.84°C at 760 mmHg |
굴절 지수 |
1.464 |
인화점 |
155.577°C |
증기압 |
0.003mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|