ChemNet > CAS > 287172-74-1 2-Chloro-3,6-difluorobenzoic acid
287172-74-1 2-Chloro-3,6-difluorobenzoic acid
상품명칭 |
2-Chloro-3,6-difluorobenzoic acid |
영문 이름 |
2-Chloro-3,6-difluorobenzoic acid; |
분자식 |
C7H3ClF2O2 |
분자량 |
192.5473 |
InChI |
InChI=1/C7H3ClF2O2/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2H,(H,11,12) |
cas번호 |
287172-74-1 |
분자 구조 |
|
밀도 |
1.573g/cm3 |
비등점 |
266.6°C at 760 mmHg |
굴절 지수 |
1.534 |
인화점 |
115°C |
증기압 |
0.00427mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|