28741-08-4 n-Octylboronic acid
| 상품명칭 |
n-Octylboronic acid |
| 영문 이름 |
n-Octylboronic acid; Caprylboronic acid; n-Octaneboronic acid; octylboronic acid; 1-Octylboronic acid |
| 분자식 |
C8H19BO2 |
| 분자량 |
158.0463 |
| InChI |
InChI=1/C8H19BO2/c1-2-3-4-5-6-7-8-9(10)11/h10-11H,2-8H2,1H3 |
| cas번호 |
28741-08-4 |
| 분자 구조 |
|
| 밀도 |
0.89g/cm3 |
| 비등점 |
262.6°C at 760 mmHg |
| 굴절 지수 |
1.427 |
| 인화점 |
112.6°C |
| 증기압 |
0.00153mmHg at 25°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|