ChemNet > CAS > 28788-42-3 Decahydronaphthalene-d18
28788-42-3 Decahydronaphthalene-d18
상품명칭 |
Decahydronaphthalene-d18 |
영문 이름 |
Decahydronaphthalene-d18; Decahydronapthalene-d18; (~2~H_18_)decahydronaphthalene |
분자식 |
C10D18 |
분자량 |
156.3608 |
InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D,10D |
cas번호 |
28788-42-3 |
분자 구조 |
|
밀도 |
0.986g/cm3 |
녹는 점 |
-32℃ |
비등점 |
190.9°C at 760 mmHg |
굴절 지수 |
1.469 |
인화점 |
57.2°C |
증기압 |
0.735mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|