ChemNet > CAS > 290313-19-8 4-시클로헥실-2-메르캅토-6-옥소-1,6-디히드로피리미딘-5-카르보니트릴
290313-19-8 4-시클로헥실-2-메르캅토-6-옥소-1,6-디히드로피리미딘-5-카르보니트릴
상품명칭 |
4-시클로헥실-2-메르캅토-6-옥소-1,6-디히드로피리미딘-5-카르보니트릴 |
별명 |
6-시클로헥실-4-옥소-2-티옥소-1,2,3,4-테트라히드로피리미딘-5-카르보니트릴 |
영문 이름 |
4-cyclohexyl-2-mercapto-6-oxo-1,6-dihydropyrimidine-5-carbonitrile;6-cyclohexyl-4-oxo-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile |
분자식 |
C11H13N3OS |
분자량 |
235.3054 |
InChI |
InChI=1/C11H13N3OS/c12-6-8-9(7-4-2-1-3-5-7)13-11(16)14-10(8)15/h7H,1-5H2,(H2,13,14,15,16) |
cas번호 |
290313-19-8 |
분자 구조 |
|
밀도 |
1.32g/cm3 |
녹는 점 |
300℃ |
굴절 지수 |
1.622 |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|