ChemNet > CAS > 2946-61-4 Dimethyl phenylphosphonite
2946-61-4 Dimethyl phenylphosphonite
| 상품명칭 |
Dimethyl phenylphosphonite |
| 영문 이름 |
Dimethyl phenylphosphonite; Dimethoxyphenylphosphine; Phenyldimethoxyphosphine; Phenylphosphonous acid dimethyl ester |
| 분자식 |
C8H11O2P |
| 분자량 |
170.1455 |
| InChI |
InChI=1/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| cas번호 |
2946-61-4 |
| EC번호 |
220-960-6 |
| 분자 구조 |
|
| 비등점 |
194.1°C at 760 mmHg |
| 인화점 |
81°C |
| 증기압 |
0.628mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
