ChemNet > CAS > 29682-39-1 1-Bromo-2-chloro-4-nitrobenzene
29682-39-1 1-Bromo-2-chloro-4-nitrobenzene
| 상품명칭 |
1-Bromo-2-chloro-4-nitrobenzene |
| 영문 이름 |
1-Bromo-2-chloro-4-nitrobenzene; 4-Bromo-3-chloronitrobenzene |
| 분자식 |
C6H3BrClNO2 |
| 분자량 |
236.4505 |
| InChI |
InChI=1/C6H3BrClNO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H |
| cas번호 |
29682-39-1 |
| EC번호 |
249-773-8 |
| 분자 구조 |
|
| 밀도 |
1.827g/cm3 |
| 비등점 |
282.2°C at 760 mmHg |
| 굴절 지수 |
1.618 |
| 인화점 |
124.5°C |
| 증기압 |
0.0058mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
