ChemNet > CAS > 2976-74-1 2,3-Dichlorophenoxyacetic acid
2976-74-1 2,3-Dichlorophenoxyacetic acid
상품명칭 |
2,3-Dichlorophenoxyacetic acid |
영문 이름 |
2,3-Dichlorophenoxyacetic acid;NSC 74462; Acetic acid, (2,3-dichlorophenoxy)- (8CI)(9CI); (2,3-dichlorophenoxy)acetate; 2-(2,3-Dichlorophenoxy)acetic acid |
분자식 |
C8H5Cl2O3 |
분자량 |
220.03 |
InChI |
InChI=1/C8H6Cl2O3/c9-5-2-1-3-6(8(5)10)13-4-7(11)12/h1-3H,4H2,(H,11,12)/p-1 |
cas번호 |
2976-74-1 |
EC번호 |
221-022-9 |
분자 구조 |
|
녹는 점 |
172-175℃ |
비등점 |
348.4°C at 760 mmHg |
인화점 |
164.5°C |
증기압 |
1.9E-05mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|