2981-10-4 1-(1-Piperidino)cyclohexene

상품명칭	1-(1-Piperidino)cyclohexene
영문 이름	1-(1-Piperidino)cyclohexene; 1-(Cyclohexen-1-yl)piperidine; 1-(cyclohex-1-en-1-yl)piperidine; 1-Piperidino-1-cyclohexene
분자식	C₁₁H₁₉N
분자량	165.2753
InChI	InChI=1/C11H19N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h7H,1-6,8-10H2
cas번호	2981-10-4
분자 구조
밀도	0.978g/cm³
비등점	262.2°C at 760 mmHg
굴절 지수	1.527
인화점	102.8°C
증기압	0.011mmHg at 25°C
위험성 표시
리스크 규칙	R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;