ChemNet > CAS > 29886-63-3 3-(2-thienyl)benzoic acid
29886-63-3 3-(2-thienyl)benzoic acid
상품명칭 |
3-(2-thienyl)benzoic acid |
영문 이름 |
3-(2-thienyl)benzoic acid;3-(thiophen-2-yl)benzoic acid; 3-thiophen-2-ylbenzoate |
분자식 |
C11H7O2S |
분자량 |
203.2376 |
InChI |
InChI=1/C11H8O2S/c12-11(13)9-4-1-3-8(7-9)10-5-2-6-14-10/h1-7H,(H,12,13)/p-1 |
cas번호 |
29886-63-3 |
분자 구조 |
|
녹는 점 |
166℃ |
비등점 |
393.6°C at 760 mmHg |
인화점 |
191.8°C |
증기압 |
6.71E-07mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|