300-08-3 Arecoline hydrobromide
상품명칭 |
Arecoline hydrobromide |
영문 이름 |
Arecoline hydrobromide;methyl 1,2,5,6-tetrahydro-1-methyl-3-pyridinecarboxylate hydrobromide; methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrobromide (1:1); 1-Methyl-1,2,5,6-tetrahydro-3-pyridinecarboxylic acid methyl ester hydrobromide; Arecoline HBr |
분자식 |
C8H14BrNO2 |
분자량 |
236.1063 |
InChI |
InChI=1/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H |
cas번호 |
300-08-3 |
EC번호 |
206-087-3 |
분자 구조 |
|
녹는 점 |
171-174℃ |
비등점 |
209°C at 760 mmHg |
인화점 |
81.1°C |
증기압 |
0.208mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:;
|
보안 규칙 |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|