ChemNet > CAS > 3017-95-6 2-bromo-1-chloropropane
3017-95-6 2-bromo-1-chloropropane
| 상품명칭 |
2-bromo-1-chloropropane |
| 영문 이름 |
2-bromo-1-chloropropane;Propane, 2-bromo-1-chloro-; 1-Chloro-2-bromopropane; 2-Bromo-1-chloropropane; NSC 8022; (2S)-2-bromo-1-chloropropane |
| 분자식 |
C3H6BrCl |
| 분자량 |
157.4367 |
| InChI |
InChI=1/C3H6BrCl/c1-3(4)2-5/h3H,2H2,1H3/t3-/m0/s1 |
| cas번호 |
3017-95-6 |
| EC번호 |
221-157-3 |
| 분자 구조 |
|
| 밀도 |
1.528g/cm3 |
| 비등점 |
115.3°C at 760 mmHg |
| 굴절 지수 |
1.465 |
| 인화점 |
27.6°C |
| 증기압 |
22.7mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
