ChemNet > CAS > 3019-20-3 Isopropylthiobenzene
3019-20-3 Isopropylthiobenzene
| 상품명칭 |
Isopropylthiobenzene |
| 영문 이름 |
Isopropylthiobenzene; (Isopropylthio)benzene; Isopropyl phenyl sulphide; (propan-2-ylsulfanyl)benzene |
| 분자식 |
C9H12S |
| 분자량 |
152.2566 |
| InChI |
InChI=1/C9H12S/c1-8(2)10-9-6-4-3-5-7-9/h3-8H,1-2H3 |
| cas번호 |
3019-20-3 |
| EC번호 |
221-162-0 |
| 분자 구조 |
|
| 밀도 |
0.98g/cm3 |
| 비등점 |
208°C at 760 mmHg |
| 굴절 지수 |
1.544 |
| 인화점 |
83.2°C |
| 증기압 |
0.315mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
