ChemNet > CAS > 3027-13-2 3-Methoxyphenylacetone
3027-13-2 3-Methoxyphenylacetone
| 상품명칭 |
3-Methoxyphenylacetone |
| 영문 이름 |
3-Methoxyphenylacetone; 1-(3-Methoxyphenyl)-2-propanone; 1-(3-methoxyphenyl)propan-2-one |
| 분자식 |
C10H12O2 |
| 분자량 |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(11)6-9-4-3-5-10(7-9)12-2/h3-5,7H,6H2,1-2H3 |
| cas번호 |
3027-13-2 |
| EC번호 |
221-191-9 |
| 분자 구조 |
|
| 밀도 |
1.027g/cm3 |
| 비등점 |
259°C at 760 mmHg |
| 굴절 지수 |
1.501 |
| 인화점 |
102.7°C |
| 증기압 |
0.0133mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
