30273-11-1 4-sec-Butylaniline
상품명칭 |
4-sec-Butylaniline |
영문 이름 |
4-sec-Butylaniline; benzenamine, 4-(1-methylpropyl)-; p-sec-Butylaniline; 4-(butan-2-yl)aniline; N-(1-methylpropyl)-benzenamine |
분자식 |
C10H15N |
분자량 |
149.2328 |
InChI |
InChI=1/C10H15N/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8H,3,11H2,1-2H3 |
cas번호 |
30273-11-1 |
EC번호 |
250-108-9 |
분자 구조 |
|
밀도 |
0.942g/cm3 |
비등점 |
244.2°C at 760 mmHg |
굴절 지수 |
1.535 |
인화점 |
107.8°C |
증기압 |
0.0308mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|