3034-19-3 2-Nitrophenylhydrazine
상품명칭 |
2-Nitrophenylhydrazine |
영문 이름 |
2-Nitrophenylhydrazine; BRN 0512797; Hydrazine, (o-nitrophenyl)- |
분자식 |
C6H7N3O2 |
분자량 |
153.1387 |
InChI |
InChI=1/C6H7N3O2/c7-8-5-3-1-2-4-6(5)9(10)11/h1-4,8H,7H2 |
cas번호 |
3034-19-3 |
EC번호 |
221-222-6 |
분자 구조 |
|
밀도 |
1.419g/cm3 |
녹는 점 |
89-94℃ |
비등점 |
314.3°C at 760 mmHg |
굴절 지수 |
1.691 |
인화점 |
143.9°C |
증기압 |
0.000469mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R5:Heating may cause an explosion.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|