ChemNet > CAS > 305-53-3 Iodoacetic acid, sodium salt
305-53-3 Iodoacetic acid, sodium salt
상품명칭 |
Iodoacetic acid, sodium salt |
영문 이름 |
Iodoacetic acid, sodium salt; Sodium iodoacetate; Iodoacetic acid sodium salt |
분자식 |
C2H2INaO2 |
분자량 |
207.9303 |
InChI |
InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
cas번호 |
305-53-3 |
EC번호 |
206-165-7 |
분자 구조 |
|
녹는 점 |
208-210℃ |
비등점 |
262.1°C at 760 mmHg |
인화점 |
112.3°C |
증기압 |
0.00329mmHg at 25°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R25:Toxic if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|