ChemNet > CAS > 30544-34-4 2,3-Dibromofuran
30544-34-4 2,3-Dibromofuran
| 상품명칭 |
2,3-Dibromofuran |
| 영문 이름 |
2,3-Dibromofuran; |
| 분자식 |
C4H2Br2O |
| 분자량 |
225.8661 |
| InChI |
InChI=1/C4H2Br2O/c5-3-1-2-7-4(3)6/h1-2H |
| cas번호 |
30544-34-4 |
| 분자 구조 |
|
| 밀도 |
2.159g/cm3 |
| 비등점 |
175.6°C at 760 mmHg |
| 굴절 지수 |
1.562 |
| 인화점 |
60°C |
| 증기압 |
1.53mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
