ChemNet > CAS > 30595-79-0 2,6-Dichlorophenethylalcohol
30595-79-0 2,6-Dichlorophenethylalcohol
상품명칭 |
2,6-Dichlorophenethylalcohol |
영문 이름 |
2,6-Dichlorophenethylalcohol;2-(2,6-dichlorophenyl)ethanol |
분자식 |
C8H8Cl2O |
분자량 |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3,11H,4-5H2 |
cas번호 |
30595-79-0 |
분자 구조 |
|
밀도 |
1.329g/cm3 |
녹는 점 |
59℃ |
비등점 |
276.6°C at 760 mmHg |
굴절 지수 |
1.569 |
인화점 |
117.2°C |
증기압 |
0.00229mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|