3063-20-5 에틸암모늄 에틸디티오카르바메이트
상품명칭 |
에틸암모늄 에틸디티오카르바메이트 |
별명 |
카르바모디티오산, N-에틸-, 에탄아민 compd.with (1:1); 카르바믹산, 에틸디티오-, compd.에틸아민 (1:1); 카르바모디티오산, 에틸-, compd.with 에탄아민 (1:1); 에틸암모늄 에틸디티오카르바메이트; NSC 87902; 에틸 카르 바 모디 티오 산 - 에탄 아민 (1 : 1) |
영문 이름 |
ethylammonium ethyldithiocarbamate;Carbamodithioic acid, N-ethyl-, compd. with ethanamine (1:1); Carbamic acid, ethyldithio-, compd. with ethylamine (1:1); Carbamodithioic acid, ethyl-, compd. with ethanamine (1:1); Ethylammonium ethyldithiocarbamate; NSC 87902; ethylcarbamodithioic acid - ethanamine (1:1) |
분자식 |
C5H14N2S2 |
분자량 |
166.3081 |
InChI |
InChI=1/C3H7NS2.C2H7N/c1-2-4-3(5)6;1-2-3/h2H2,1H3,(H2,4,5,6);2-3H2,1H3 |
cas번호 |
3063-20-5 |
EC번호 |
221-308-3 |
분자 구조 |
|
비등점 |
144.3°C at 760 mmHg |
인화점 |
41.1°C |
증기압 |
5.13mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|