3068-88-0 beta-butyrolactone
상품명칭 |
beta-butyrolactone |
영문 이름 |
beta-butyrolactone; Butyrolactone; dl-B-hydroxybutyric acid lactone; 3-Hydroxybutyric acid lactone; 4-Methyl-2-oxetanone; 2-Methyl-beta-propiolactone; dihydrofuran-2(3H)-one; (4R)-4-methyloxetan-2-one; (4S)-4-methyloxetan-2-one; (R)-BETA-BUTYROLACTONE |
분자식 |
C4H6O2 |
분자량 |
86.0892 |
InChI |
InChI=1/C4H6O2/c1-3-2-4(5)6-3/h3H,2H2,1H3/t3-/m0/s1 |
cas번호 |
3068-88-0 |
EC번호 |
221-330-3 |
분자 구조 |
|
밀도 |
1.096g/cm3 |
비등점 |
163.2°C at 760 mmHg |
굴절 지수 |
1.429 |
인화점 |
34.1°C |
증기압 |
2.09mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R45:May cause cancer.;
|
보안 규칙 |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|