ChemNet > CAS > 306934-87-2 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde
306934-87-2 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde
| 상품명칭 |
6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde |
| 영문 이름 |
6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde; 6-Fluoro-1,3-benzodioxene-8-carbaldehyde |
| 분자식 |
C9H7FO3 |
| 분자량 |
182.1485 |
| InChI |
InChI=1/C9H7FO3/c10-8-1-6(3-11)9-7(2-8)4-12-5-13-9/h1-3H,4-5H2 |
| cas번호 |
306934-87-2 |
| 분자 구조 |
|
| 밀도 |
1.357g/cm3 |
| 녹는 점 |
116℃ |
| 비등점 |
323.051°C at 760 mmHg |
| 굴절 지수 |
1.566 |
| 인화점 |
144.319°C |
| 증기압 |
0mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
