ChemNet > CAS > 306934-95-2 5-페닐-2-티에닐보론산
306934-95-2 5-페닐-2-티에닐보론산
상품명칭 |
5-페닐-2-티에닐보론산 |
별명 |
;(5-Phenyl-2-thienyl)보론산; 붕산, B- (5- 페닐 -2- 티에닐) -; (5-페닐티오펜-2-일)보론산; 2-페니티오펜-5-일보론산 |
영문 이름 |
5-phenyl-2-thienylboronic acid; (5-Phenyl-2-thienyl)boronic acid; boronic acid, B-(5-phenyl-2-thienyl)-; (5-phenylthiophen-2-yl)boronic acid; 2-phenythiophen-5-ylboronic acid |
분자식 |
C10H9BO2S |
분자량 |
204.0533 |
InChI |
InChI=1/C10H9BO2S/c12-11(13)10-7-6-9(14-10)8-4-2-1-3-5-8/h1-7,12-13H |
cas번호 |
306934-95-2 |
분자 구조 |
|
밀도 |
1.29g/cm3 |
녹는 점 |
146℃ |
비등점 |
412.9°C at 760 mmHg |
굴절 지수 |
1.632 |
인화점 |
203.5°C |
증기압 |
1.47E-07mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|